C17H15ClN2O4 — CID 123798896
6-[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]oxy-5-chloropyran-2-one (PubChem CID 123798896) has the molecular formula C17H15ClN2O4 and a molecular weight of 346.77 g/mol. Its IUPAC name is 6-[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]oxy-5-chloropyran-2-one.
| Compound Name | 6-[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]oxy-5-chloropyran-2-one |
|---|---|
| PubChem CID | 123798896 |
| Molecular Formula | C17H15ClN2O4 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 6-[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]oxy-5-chloropyran-2-one |
| SMILES | O=c1ccc(Cl)c(OC2CCN(c3nc4ccccc4o3)CC2)o1 |
| InChI | InChI=1S/C17H15ClN2O4/c18-12-5-6-15(21)24-16(12)22-11-7-9-20(10-8-11)17-19-13-3-1-2-4-14(13)23-17/h1-6,11H,7-10H2 |
| InChIKey | DAVGFHDXTKWRLL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |