C14H17F2N5O3 — CID 133406970
5-(2,6-difluoro-4-nitroanilino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 133406970) has the molecular formula C14H17F2N5O3 and a molecular weight of 341.32 g/mol. Its IUPAC name is 5-(2,6-difluoro-4-nitroanilino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | 5-(2,6-difluoro-4-nitroanilino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 133406970 |
| Molecular Formula | C14H17F2N5O3 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 5-(2,6-difluoro-4-nitroanilino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | NC(=O)C1NNC2CCC(Nc3c(F)cc([N+](=O)[O-])cc3F)CC21 |
| InChI | InChI=1S/C14H17F2N5O3/c15-9-4-7(21(23)24)5-10(16)13(9)18-6-1-2-11-8(3-6)12(14(17)22)20-19-11/h4-6,8,11-12,18-20H,1-3H2,(H2,17,22) |
| InChIKey | BZTGIQPNCVCZDH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|