C18H20FN3O2 — CID 133407065
ethyl 4-[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]pentanoate (PubChem CID 133407065) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is ethyl 4-[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]pentanoate.
| Compound Name | ethyl 4-[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]pentanoate |
|---|---|
| PubChem CID | 133407065 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | ethyl 4-[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]pentanoate |
| SMILES | CCOC(=O)CCC(C)Nc1c(C#N)cnc2c(C)cc(F)cc12 |
| InChI | InChI=1S/C18H20FN3O2/c1-4-24-16(23)6-5-12(3)22-18-13(9-20)10-21-17-11(2)7-14(19)8-15(17)18/h7-8,10,12H,4-6H2,1-3H3,(H,21,22) |
| InChIKey | YPORFMDRINCIHN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |