C18H13FN4O2 — CID 133319660
6-fluoro-8-methyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile (PubChem CID 133319660) has the molecular formula C18H13FN4O2 and a molecular weight of 336.33 g/mol. Its IUPAC name is 6-fluoro-8-methyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile.
| Compound Name | 6-fluoro-8-methyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133319660 |
| Molecular Formula | C18H13FN4O2 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 6-fluoro-8-methyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile |
| SMILES | Cc1cc(F)cc2c(NCc3ccc([N+](=O)[O-])cc3)c(C#N)cnc12 |
| InChI | InChI=1S/C18H13FN4O2/c1-11-6-14(19)7-16-17(11)22-10-13(8-20)18(16)21-9-12-2-4-15(5-3-12)23(24)25/h2-7,10H,9H2,1H3,(H,21,22) |
| InChIKey | OKNXTHUZMPCNGF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|