C19H16N4O2 — CID 133319647
6,8-dimethyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile (PubChem CID 133319647) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 6,8-dimethyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile.
| Compound Name | 6,8-dimethyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 133319647 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 6,8-dimethyl-4-[(4-nitrophenyl)methylamino]quinoline-3-carbonitrile |
| SMILES | Cc1cc(C)c2ncc(C#N)c(NCc3ccc([N+](=O)[O-])cc3)c2c1 |
| InChI | InChI=1S/C19H16N4O2/c1-12-7-13(2)18-17(8-12)19(15(9-20)11-22-18)21-10-14-3-5-16(6-4-14)23(24)25/h3-8,11H,10H2,1-2H3,(H,21,22) |
| InChIKey | DZOZHNVJLVDJFM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|