C19H17FN4O2S — CID 133310255
4-[[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]methyl]-N-methylbenzenesulfonamide (PubChem CID 133310255) has the molecular formula C19H17FN4O2S and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-[[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 133310255 |
| Molecular Formula | C19H17FN4O2S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-[[(3-cyano-6-fluoro-8-methylquinolin-4-yl)amino]methyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CNc2c(C#N)cnc3c(C)cc(F)cc23)cc1 |
| InChI | InChI=1S/C19H17FN4O2S/c1-12-7-15(20)8-17-18(12)24-11-14(9-21)19(17)23-10-13-3-5-16(6-4-13)27(25,26)22-2/h3-8,11,22H,10H2,1-2H3,(H,23,24) |
| InChIKey | NYWIRQCQJYABIN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |