C20H18N4O — CID 133310236
3-[[(3-cyano-6,8-dimethylquinolin-4-yl)amino]methyl]benzamide (PubChem CID 133310236) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[[(3-cyano-6,8-dimethylquinolin-4-yl)amino]methyl]benzamide.
| Compound Name | 3-[[(3-cyano-6,8-dimethylquinolin-4-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 133310236 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-[[(3-cyano-6,8-dimethylquinolin-4-yl)amino]methyl]benzamide |
| SMILES | Cc1cc(C)c2ncc(C#N)c(NCc3cccc(C(N)=O)c3)c2c1 |
| InChI | InChI=1S/C20H18N4O/c1-12-6-13(2)18-17(7-12)19(16(9-21)11-24-18)23-10-14-4-3-5-15(8-14)20(22)25/h3-8,11H,10H2,1-2H3,(H2,22,25)(H,23,24) |
| InChIKey | PXHBBAXGIVORIH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |