C17H17BrN2O2 — CID 133407162
5-bromo-2-[1-(3,4-dimethoxyphenyl)ethylamino]benzonitrile (PubChem CID 133407162) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is 5-bromo-2-[1-(3,4-dimethoxyphenyl)ethylamino]benzonitrile.
| Compound Name | 5-bromo-2-[1-(3,4-dimethoxyphenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133407162 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 5-bromo-2-[1-(3,4-dimethoxyphenyl)ethylamino]benzonitrile |
| SMILES | COc1ccc(C(C)Nc2ccc(Br)cc2C#N)cc1OC |
| InChI | InChI=1S/C17H17BrN2O2/c1-11(12-4-7-16(21-2)17(9-12)22-3)20-15-6-5-14(18)8-13(15)10-19/h4-9,11,20H,1-3H3 |
| InChIKey | MVQROKQMMLCUES-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |