C18H19FN2O3 — CID 133316871
5-fluoro-2-[1-(3,4,5-trimethoxyphenyl)ethylamino]benzonitrile (PubChem CID 133316871) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is 5-fluoro-2-[1-(3,4,5-trimethoxyphenyl)ethylamino]benzonitrile.
| Compound Name | 5-fluoro-2-[1-(3,4,5-trimethoxyphenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133316871 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 5-fluoro-2-[1-(3,4,5-trimethoxyphenyl)ethylamino]benzonitrile |
| SMILES | COc1cc(C(C)Nc2ccc(F)cc2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C18H19FN2O3/c1-11(21-15-6-5-14(19)7-13(15)10-20)12-8-16(22-2)18(24-4)17(9-12)23-3/h5-9,11,21H,1-4H3 |
| InChIKey | UUZSQTZULNOWFU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |