C21H19N7S — CID 133409093
5-amino-1-phenyl-3-[3-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]propyl]pyrazole-4-carbonitrile (PubChem CID 133409093) has the molecular formula C21H19N7S and a molecular weight of 401.50 g/mol. Its IUPAC name is 5-amino-1-phenyl-3-[3-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]propyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-phenyl-3-[3-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]propyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 133409093 |
| Molecular Formula | C21H19N7S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 5-amino-1-phenyl-3-[3-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]propyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(CCCNc2nnc(-c3ccccc3)s2)nn(-c2ccccc2)c1N |
| InChI | InChI=1S/C21H19N7S/c22-14-17-18(27-28(19(17)23)16-10-5-2-6-11-16)12-7-13-24-21-26-25-20(29-21)15-8-3-1-4-9-15/h1-6,8-11H,7,12-13,23H2,(H,24,26) |
| InChIKey | BRHIDZCDNLZFNG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|