C18H21N5O3 — CID 133409262
N,N-dimethyl-4-(5-nitro-6-phenyl-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 133409262) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N,N-dimethyl-4-(5-nitro-6-phenyl-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-(5-nitro-6-phenyl-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 133409262 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N,N-dimethyl-4-(5-nitro-6-phenyl-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCN(c2ccc([N+](=O)[O-])c(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C18H21N5O3/c1-20(2)18(24)22-12-10-21(11-13-22)16-9-8-15(23(25)26)17(19-16)14-6-4-3-5-7-14/h3-9H,10-13H2,1-2H3 |
| InChIKey | CSXOFLZBVXPPRP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|