C20H23N7O2 — CID 133493134
1,3-dimethyl-5-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazol-4-amine (PubChem CID 133493134) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 1,3-dimethyl-5-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazol-4-amine.
| Compound Name | 1,3-dimethyl-5-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazol-4-amine |
|---|---|
| PubChem CID | 133493134 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1,3-dimethyl-5-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazol-4-amine |
| SMILES | Cc1nn(C)c(N2CCN(c3ccc([N+](=O)[O-])c(-c4ccccc4)n3)CC2)c1N |
| InChI | InChI=1S/C20H23N7O2/c1-14-18(21)20(24(2)23-14)26-12-10-25(11-13-26)17-9-8-16(27(28)29)19(22-17)15-6-4-3-5-7-15/h3-9H,10-13,21H2,1-2H3 |
| InChIKey | FDSPTVIXTNZESZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|