C21H20N8O2 — CID 133408642
1-methyl-4-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazolo[5,4-d]pyrimidine (PubChem CID 133408642) has the molecular formula C21H20N8O2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 1-methyl-4-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-methyl-4-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 133408642 |
| Molecular Formula | C21H20N8O2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-methyl-4-[4-(5-nitro-6-phenyl-2-pyridinyl)piperazin-1-yl]pyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(N3CCN(c4ccc([N+](=O)[O-])c(-c5ccccc5)n4)CC3)ncnc21 |
| InChI | InChI=1S/C21H20N8O2/c1-26-20-16(13-24-26)21(23-14-22-20)28-11-9-27(10-12-28)18-8-7-17(29(30)31)19(25-18)15-5-3-2-4-6-15/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | XVCCUKRKNSSCCI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 106.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|