C22H19N7O3 — CID 133409355
N-[4-[(5-nitro-6-phenyl-2-pyridinyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 133409355) has the molecular formula C22H19N7O3 and a molecular weight of 429.44 g/mol. Its IUPAC name is N-[4-[(5-nitro-6-phenyl-2-pyridinyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[4-[(5-nitro-6-phenyl-2-pyridinyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 133409355 |
| Molecular Formula | C22H19N7O3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[4-[(5-nitro-6-phenyl-2-pyridinyl)amino]phenyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(Nc2ccc([N+](=O)[O-])c(-c3ccccc3)n2)cc1)n1cncn1 |
| InChI | InChI=1S/C22H19N7O3/c1-15(28-14-23-13-24-28)22(30)26-18-9-7-17(8-10-18)25-20-12-11-19(29(31)32)21(27-20)16-5-3-2-4-6-16/h2-15H,1H3,(H,25,27)(H,26,30) |
| InChIKey | NWHKMVZNPCFKOC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|