C17H26N4S — CID 133409616
6-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133409616) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is 6-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133409616 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 6-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(NCCCCN3CCC(C)CC3)ncnc2s1 |
| InChI | InChI=1S/C17H26N4S/c1-13-5-9-21(10-6-13)8-4-3-7-18-16-15-11-14(2)22-17(15)20-12-19-16/h11-13H,3-10H2,1-2H3,(H,18,19,20) |
| InChIKey | BSEOTIHIDNTFED-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|