C23H31N5O — CID 133412290
2-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-1-ethylbenzimidazole (PubChem CID 133412290) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 2-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-1-ethylbenzimidazole.
| Compound Name | 2-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-1-ethylbenzimidazole |
|---|---|
| PubChem CID | 133412290 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 2-[1-[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]pyrrolidin-2-yl]-1-ethylbenzimidazole |
| SMILES | CCn1c(C2CCCN2c2cc(COC)nc(C(C)(C)C)n2)nc2ccccc21 |
| InChI | InChI=1S/C23H31N5O/c1-6-27-18-11-8-7-10-17(18)25-21(27)19-12-9-13-28(19)20-14-16(15-29-5)24-22(26-20)23(2,3)4/h7-8,10-11,14,19H,6,9,12-13,15H2,1-5H3 |
| InChIKey | FBQDAXAYTGHLJA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |