C18H31N3O2 — CID 133412384
[2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cycloheptyl]methanol (PubChem CID 133412384) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is [2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cycloheptyl]methanol.
| Compound Name | [2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cycloheptyl]methanol |
|---|---|
| PubChem CID | 133412384 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | [2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cycloheptyl]methanol |
| SMILES | COCc1cc(NC2CCCCCC2CO)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H31N3O2/c1-18(2,3)17-19-14(12-23-4)10-16(21-17)20-15-9-7-5-6-8-13(15)11-22/h10,13,15,22H,5-9,11-12H2,1-4H3,(H,19,20,21) |
| InChIKey | DDXJEFONSWEBRF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |