C16H25N3O2 — CID 133402823
[(1S,4R)-4-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 133402823) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is [(1S,4R)-4-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1S,4R)-4-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 133402823 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | [(1S,4R)-4-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | COCc1cc(N[C@H]2C=C[C@@H](CO)C2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C16H25N3O2/c1-16(2,3)15-18-13(10-21-4)8-14(19-15)17-12-6-5-11(7-12)9-20/h5-6,8,11-12,20H,7,9-10H2,1-4H3,(H,17,18,19)/t11-,12+/m1/s1 |
| InChIKey | RPIAPUVAGVSYJF-NEPJUHHUSA-N |
| XLogP | 2.27 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|