C15H19N3O4S2 — CID 133412834
3-[1-(5-ethyl-4-methylthiophen-2-yl)ethylamino]-5-nitrobenzenesulfonamide (PubChem CID 133412834) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[1-(5-ethyl-4-methylthiophen-2-yl)ethylamino]-5-nitrobenzenesulfonamide.
| Compound Name | 3-[1-(5-ethyl-4-methylthiophen-2-yl)ethylamino]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133412834 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 3-[1-(5-ethyl-4-methylthiophen-2-yl)ethylamino]-5-nitrobenzenesulfonamide |
| SMILES | CCc1sc(C(C)Nc2cc([N+](=O)[O-])cc(S(N)(=O)=O)c2)cc1C |
| InChI | InChI=1S/C15H19N3O4S2/c1-4-14-9(2)5-15(23-14)10(3)17-11-6-12(18(19)20)8-13(7-11)24(16,21)22/h5-8,10,17H,4H2,1-3H3,(H2,16,21,22) |
| InChIKey | CWVFYTCWFVLAJM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|