C22H21F3N4O — CID 133413468
N-[2-(oxolan-3-yl)-1-phenylethyl]-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 133413468) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is N-[2-(oxolan-3-yl)-1-phenylethyl]-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[2-(oxolan-3-yl)-1-phenylethyl]-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133413468 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[2-(oxolan-3-yl)-1-phenylethyl]-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(NC(CC2CCOC2)c2ccccc2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C22H21F3N4O/c23-22(24,25)19-13-20(29-21(28-19)17-8-4-5-10-26-17)27-18(12-15-9-11-30-14-15)16-6-2-1-3-7-16/h1-8,10,13,15,18H,9,11-12,14H2,(H,27,28,29) |
| InChIKey | PBFDXVLGSNSIOR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |