C19H20F3NO3S — CID 133413514
N-[2-(oxolan-3-yl)-1-phenylethyl]-4-(trifluoromethylsulfonyl)aniline (PubChem CID 133413514) has the molecular formula C19H20F3NO3S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-[2-(oxolan-3-yl)-1-phenylethyl]-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[2-(oxolan-3-yl)-1-phenylethyl]-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 133413514 |
| Molecular Formula | C19H20F3NO3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[2-(oxolan-3-yl)-1-phenylethyl]-4-(trifluoromethylsulfonyl)aniline |
| SMILES | O=S(=O)(c1ccc(NC(CC2CCOC2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO3S/c20-19(21,22)27(24,25)17-8-6-16(7-9-17)23-18(12-14-10-11-26-13-14)15-4-2-1-3-5-15/h1-9,14,18,23H,10-13H2 |
| InChIKey | GMAZNDIJDGNKFY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |