C16H20N2O6S — CID 133414140
2-(2,5-dimethylfuran-3-yl)-1-(3-methylsulfonyl-2-nitroanilino)propan-2-ol (PubChem CID 133414140) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-(2,5-dimethylfuran-3-yl)-1-(3-methylsulfonyl-2-nitroanilino)propan-2-ol.
| Compound Name | 2-(2,5-dimethylfuran-3-yl)-1-(3-methylsulfonyl-2-nitroanilino)propan-2-ol |
|---|---|
| PubChem CID | 133414140 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-(2,5-dimethylfuran-3-yl)-1-(3-methylsulfonyl-2-nitroanilino)propan-2-ol |
| SMILES | Cc1cc(C(C)(O)CNc2cccc(S(C)(=O)=O)c2[N+](=O)[O-])c(C)o1 |
| InChI | InChI=1S/C16H20N2O6S/c1-10-8-12(11(2)24-10)16(3,19)9-17-13-6-5-7-14(25(4,22)23)15(13)18(20)21/h5-8,17,19H,9H2,1-4H3 |
| InChIKey | XXOYPULLTYTEOW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|