C11H10N4O — CID 133416561
6-[1-(furan-2-yl)ethylamino]pyridazine-3-carbonitrile (PubChem CID 133416561) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 6-[1-(furan-2-yl)ethylamino]pyridazine-3-carbonitrile.
| Compound Name | 6-[1-(furan-2-yl)ethylamino]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133416561 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 6-[1-(furan-2-yl)ethylamino]pyridazine-3-carbonitrile |
| SMILES | CC(Nc1ccc(C#N)nn1)c1ccco1 |
| InChI | InChI=1S/C11H10N4O/c1-8(10-3-2-6-16-10)13-11-5-4-9(7-12)14-15-11/h2-6,8H,1H3,(H,13,15) |
| InChIKey | JMXCDGSCHVXFAZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |