C8H11N5O — CID 63152502
N-[1-(furan-2-yl)ethyl]-1-methyltetrazol-5-amine (PubChem CID 63152502) has the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[1-(furan-2-yl)ethyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 63152502 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-1-methyltetrazol-5-amine |
| SMILES | CC(Nc1nnnn1C)c1ccco1 |
| InChI | InChI=1S/C8H11N5O/c1-6(7-4-3-5-14-7)9-8-10-11-12-13(8)2/h3-6H,1-2H3,(H,9,10,12) |
| InChIKey | IRWDICOSIARNCE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |