C10H11Cl2N5 — CID 167808600
N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-1-methyltetrazol-5-amine (PubChem CID 167808600) has the molecular formula C10H11Cl2N5 and a molecular weight of 272.14 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 167808600 |
| Molecular Formula | C10H11Cl2N5 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-1-methyltetrazol-5-amine |
| SMILES | C[C@H](Nc1nnnn1C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N5/c1-6(13-10-14-15-16-17(10)2)8-4-3-7(11)5-9(8)12/h3-6H,1-2H3,(H,13,14,16)/t6-/m0/s1 |
| InChIKey | NCIBHYYQGOKMDZ-LURJTMIESA-N |
| XLogP | 2.69 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |