C10H12ClN5 — CID 63149791
N-[1-(4-chlorophenyl)ethyl]-1-methyltetrazol-5-amine (PubChem CID 63149791) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 63149791 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-1-methyltetrazol-5-amine |
| SMILES | CC(Nc1nnnn1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClN5/c1-7(8-3-5-9(11)6-4-8)12-10-13-14-15-16(10)2/h3-7H,1-2H3,(H,12,13,15) |
| InChIKey | VSCFLMCMMWPJEI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |