C8H10ClN5S — CID 63150290
N-[1-(5-chlorothiophen-2-yl)ethyl]-1-methyltetrazol-5-amine (PubChem CID 63150290) has the molecular formula C8H10ClN5S and a molecular weight of 243.72 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 63150290 |
| Molecular Formula | C8H10ClN5S |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-1-methyltetrazol-5-amine |
| SMILES | CC(Nc1nnnn1C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H10ClN5S/c1-5(6-3-4-7(9)15-6)10-8-11-12-13-14(8)2/h3-5H,1-2H3,(H,10,11,13) |
| InChIKey | GIYGXHACTVRGDS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |