C17H16Cl2N4O — CID 133416634
2-[(6-cyano-2-pyridinyl)-propylamino]-N-(2,4-dichlorophenyl)acetamide (PubChem CID 133416634) has the molecular formula C17H16Cl2N4O and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-[(6-cyano-2-pyridinyl)-propylamino]-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(6-cyano-2-pyridinyl)-propylamino]-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 133416634 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-[(6-cyano-2-pyridinyl)-propylamino]-N-(2,4-dichlorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(Cl)cc1Cl)c1cccc(C#N)n1 |
| InChI | InChI=1S/C17H16Cl2N4O/c1-2-8-23(16-5-3-4-13(10-20)21-16)11-17(24)22-15-7-6-12(18)9-14(15)19/h3-7,9H,2,8,11H2,1H3,(H,22,24) |
| InChIKey | MBSSRVGASSIWCX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |