C15H22N4O3 — CID 133417574
1-[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]cyclohexyl]pyrrolidine-2,5-dione (PubChem CID 133417574) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]cyclohexyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]cyclohexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 133417574 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[4-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)amino]cyclohexyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)c1noc(NC2CCC(N3C(=O)CCC3=O)CC2)n1 |
| InChI | InChI=1S/C15H22N4O3/c1-9(2)14-17-15(22-18-14)16-10-3-5-11(6-4-10)19-12(20)7-8-13(19)21/h9-11H,3-8H2,1-2H3,(H,16,17,18) |
| InChIKey | SVUXQRZOYCMNOW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|