C17H24N4O3 — CID 133417652
1-[4-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-2,5-dione (PubChem CID 133417652) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[4-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 133417652 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[4-[[2-(methoxymethyl)-6-methylpyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-2,5-dione |
| SMILES | COCc1nc(C)cc(NC2CCC(N3C(=O)CCC3=O)CC2)n1 |
| InChI | InChI=1S/C17H24N4O3/c1-11-9-14(20-15(18-11)10-24-2)19-12-3-5-13(6-4-12)21-16(22)7-8-17(21)23/h9,12-13H,3-8,10H2,1-2H3,(H,18,19,20) |
| InChIKey | CHLCGDBAQCLZGE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|