C16H18FN7 — CID 133419744
3-[4-(6-ethyl-5-fluoropyrimidin-4-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 133419744) has the molecular formula C16H18FN7 and a molecular weight of 327.37 g/mol. Its IUPAC name is 3-[4-(6-ethyl-5-fluoropyrimidin-4-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[4-(6-ethyl-5-fluoropyrimidin-4-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133419744 |
| Molecular Formula | C16H18FN7 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[4-(6-ethyl-5-fluoropyrimidin-4-yl)-3-methylpiperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | CCc1ncnc(N2CCN(c3nccnc3C#N)CC2C)c1F |
| InChI | InChI=1S/C16H18FN7/c1-3-12-14(17)16(22-10-21-12)24-7-6-23(9-11(24)2)15-13(8-18)19-4-5-20-15/h4-5,10-11H,3,6-7,9H2,1-2H3 |
| InChIKey | PNUZJFIGTITPFV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |