C18H29FN4O2 — CID 133419965
tert-butyl N-[1-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]ethyl]carbamate (PubChem CID 133419965) has the molecular formula C18H29FN4O2 and a molecular weight of 352.45 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 133419965 |
| Molecular Formula | C18H29FN4O2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | tert-butyl N-[1-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]ethyl]carbamate |
| SMILES | CCc1ncnc(N2CCCC(C(C)NC(=O)OC(C)(C)C)C2)c1F |
| InChI | InChI=1S/C18H29FN4O2/c1-6-14-15(19)16(21-11-20-14)23-9-7-8-13(10-23)12(2)22-17(24)25-18(3,4)5/h11-13H,6-10H2,1-5H3,(H,22,24) |
| InChIKey | HKKIORIXENOLIC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |