C18H21BrN2O3 — CID 133420288
methyl 6-[[2-(4-bromophenyl)-2-hydroxybutyl]amino]-2-methylpyridine-3-carboxylate (PubChem CID 133420288) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is methyl 6-[[2-(4-bromophenyl)-2-hydroxybutyl]amino]-2-methylpyridine-3-carboxylate.
| Compound Name | methyl 6-[[2-(4-bromophenyl)-2-hydroxybutyl]amino]-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 133420288 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | methyl 6-[[2-(4-bromophenyl)-2-hydroxybutyl]amino]-2-methylpyridine-3-carboxylate |
| SMILES | CCC(O)(CNc1ccc(C(=O)OC)c(C)n1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H21BrN2O3/c1-4-18(23,13-5-7-14(19)8-6-13)11-20-16-10-9-15(12(2)21-16)17(22)24-3/h5-10,23H,4,11H2,1-3H3,(H,20,21) |
| InChIKey | XPTSFQWEDARESX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |