C17H17FN4O — CID 133421655
6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidin-1-yl]pyridazine-3-carbonitrile (PubChem CID 133421655) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidin-1-yl]pyridazine-3-carbonitrile.
| Compound Name | 6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidin-1-yl]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133421655 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 6-[2-[2-(4-fluorophenyl)-2-hydroxyethyl]pyrrolidin-1-yl]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCCC2CC(O)c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C17H17FN4O/c18-13-5-3-12(4-6-13)16(23)10-15-2-1-9-22(15)17-8-7-14(11-19)20-21-17/h3-8,15-16,23H,1-2,9-10H2 |
| InChIKey | GIPOEJPQFNHUIX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |