C17H27FN4O2 — CID 133421726
tert-butyl N-[[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate (PubChem CID 133421726) has the molecular formula C17H27FN4O2 and a molecular weight of 338.43 g/mol. Its IUPAC name is tert-butyl N-[[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 133421726 |
| Molecular Formula | C17H27FN4O2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | tert-butyl N-[[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate |
| SMILES | CCc1ncnc(N2CCCCC2CNC(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C17H27FN4O2/c1-5-13-14(18)15(21-11-20-13)22-9-7-6-8-12(22)10-19-16(23)24-17(2,3)4/h11-12H,5-10H2,1-4H3,(H,19,23) |
| InChIKey | QYEAGQYLQSTKST-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |