C14H15Cl2NO3 — CID 13342230
propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate (PubChem CID 13342230) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate.
| Compound Name | propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate |
|---|---|
| PubChem CID | 13342230 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate |
| SMILES | C=C(CC(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)OC(C)C |
| InChI | InChI=1S/C14H15Cl2NO3/c1-8(2)20-14(19)9(3)4-13(18)17-12-6-10(15)5-11(16)7-12/h5-8H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | MUTQRWUFRWSIKX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|