About propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate
propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate (PubChem CID 13342230) has the molecular formula C14H15Cl2NO3
and a molecular weight of 316.18 g/mol. Its IUPAC name is propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate.
Molecular Properties
| Compound Name | propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate |
| PubChem CID | 13342230 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate |
| SMILES | C=C(CC(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)OC(C)C |
| InChI | InChI=1S/C14H15Cl2NO3/c1-8(2)20-14(19)9(3)4-13(18)17-12-6-10(15)5-11(16)7-12/h5-8H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | MUTQRWUFRWSIKX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate?
The IUPAC name of propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate (CID 13342230) is propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate.
What is the SMILES notation for propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate?
The canonical SMILES for propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate is C=C(CC(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate?
The InChIKey is MUTQRWUFRWSIKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO3/c1-8(2)20-14(19)9(3)4-13(18)17-12-6-10(15)5-11(16)7-12/h5-8H,3-4H2,1-2H3,(H,17,18).
What are the key properties of propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate?
propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate has a molecular weight of 316.18 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-(3,5-dichloroanilino)-2-methylidene-4-oxobutanoate is sourced from PubChem (CID 13342230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).