C17H21Cl2NO3 — CID 70505282
propan-2-yl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-propan-2-yloxybutanoate (PubChem CID 70505282) has the molecular formula C17H21Cl2NO3 and a molecular weight of 358.27 g/mol. Its IUPAC name is propan-2-yl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-propan-2-yloxybutanoate.
| Compound Name | propan-2-yl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-propan-2-yloxybutanoate |
|---|---|
| PubChem CID | 70505282 |
| Molecular Formula | C17H21Cl2NO3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | propan-2-yl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-propan-2-yloxybutanoate |
| SMILES | C=C(C/C(=N/c1cc(Cl)cc(Cl)c1)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C17H21Cl2NO3/c1-10(2)22-16(6-12(5)17(21)23-11(3)4)20-15-8-13(18)7-14(19)9-15/h7-11H,5-6H2,1-4H3/b20-16- |
| InChIKey | NSLILVAKWWSOPG-SILNSSARSA-N |
| XLogP | 5.35 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|