C17H17Cl2NO3 — CID 70506126
prop-2-enyl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-prop-2-enoxybutanoate (PubChem CID 70506126) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is prop-2-enyl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-prop-2-enoxybutanoate.
| Compound Name | prop-2-enyl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-prop-2-enoxybutanoate |
|---|---|
| PubChem CID | 70506126 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | prop-2-enyl 4-(3,5-dichlorophenyl)imino-2-methylidene-4-prop-2-enoxybutanoate |
| SMILES | C=CCOC(=O)C(=C)C/C(=N/c1cc(Cl)cc(Cl)c1)OCC=C |
| InChI | InChI=1S/C17H17Cl2NO3/c1-4-6-22-16(8-12(3)17(21)23-7-5-2)20-15-10-13(18)9-14(19)11-15/h4-5,9-11H,1-3,6-8H2/b20-16- |
| InChIKey | RELARPSEBMCNOE-SILNSSARSA-N |
| XLogP | 4.90 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|