methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate

C15H11Cl2NO2 — CID 88699654

IUPACmethyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate
SMILESCOC(=O)/C(=N\c1cc(Cl)cc(Cl)c1)c1ccccc1
InChIInChI=1S/C15H11Cl2NO2/c1-20-15(19)14(10-5-3-2-4-6-10)18-13-8-11(16)7-12(17)9-13/h2-9H,1H3/b18-14-
InChIKeyMDSQWIVUDLPNPM-JXAWBTAJSA-N
MW308.16 g/mol
LogP4.29
Rot. Bonds3

About methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate

methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate (PubChem CID 88699654) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate.

Molecular Properties

Compound Namemethyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate
PubChem CID88699654
Molecular FormulaC15H11Cl2NO2
Molecular Weight308.16 g/mol
Exact Mass307.02
IUPAC Namemethyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate
SMILESCOC(=O)/C(=N\c1cc(Cl)cc(Cl)c1)c1ccccc1
InChIInChI=1S/C15H11Cl2NO2/c1-20-15(19)14(10-5-3-2-4-6-10)18-13-8-11(16)7-12(17)9-13/h2-9H,1H3/b18-14-
InChIKeyMDSQWIVUDLPNPM-JXAWBTAJSA-N
XLogP4.29
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.16
LogP ≤ 54.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate?
The IUPAC name of methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate (CID 88699654) is methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate.
What is the SMILES notation for methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate?
The canonical SMILES for methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate is COC(=O)/C(=N\c1cc(Cl)cc(Cl)c1)c1ccccc1.
What is the InChIKey of methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate?
The InChIKey is MDSQWIVUDLPNPM-JXAWBTAJSA-N. The full InChI is InChI=1S/C15H11Cl2NO2/c1-20-15(19)14(10-5-3-2-4-6-10)18-13-8-11(16)7-12(17)9-13/h2-9H,1H3/b18-14-.
What are the key properties of methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate?
methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate has a molecular weight of 308.16 g/mol, XLogP of 4.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate is sourced from PubChem (CID 88699654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).