C15H11Cl2NO2 — CID 88699654
methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate (PubChem CID 88699654) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate.
| Compound Name | methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate |
|---|---|
| PubChem CID | 88699654 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | methyl 2-(3,5-dichlorophenyl)imino-2-phenylacetate |
| SMILES | COC(=O)/C(=N\c1cc(Cl)cc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C15H11Cl2NO2/c1-20-15(19)14(10-5-3-2-4-6-10)18-13-8-11(16)7-12(17)9-13/h2-9H,1H3/b18-14- |
| InChIKey | MDSQWIVUDLPNPM-JXAWBTAJSA-N |
| XLogP | 4.29 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|