C30H40Cl4N2O4 — CID 56984014
bis[5-amino-1-(3,5-dichlorophenyl)-2,2-dimethylhexan-3-yl] oxalate (PubChem CID 56984014) has the molecular formula C30H40Cl4N2O4 and a molecular weight of 634.47 g/mol. Its IUPAC name is bis[5-amino-1-(3,5-dichlorophenyl)-2,2-dimethylhexan-3-yl] oxalate.
| Compound Name | bis[5-amino-1-(3,5-dichlorophenyl)-2,2-dimethylhexan-3-yl] oxalate |
|---|---|
| PubChem CID | 56984014 |
| Molecular Formula | C30H40Cl4N2O4 |
| Molecular Weight | 634.47 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | bis[5-amino-1-(3,5-dichlorophenyl)-2,2-dimethylhexan-3-yl] oxalate |
| SMILES | CC(N)CC(OC(=O)C(=O)OC(CC(C)N)C(C)(C)Cc1cc(Cl)cc(Cl)c1)C(C)(C)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C30H40Cl4N2O4/c1-17(35)7-25(29(3,4)15-19-9-21(31)13-22(32)10-19)39-27(37)28(38)40-26(8-18(2)36)30(5,6)16-20-11-23(33)14-24(34)12-20/h9-14,17-18,25-26H,7-8,15-16,35-36H2,1-6H3 |
| InChIKey | SVXFTHUWTHVXJD-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.47 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|