C14H14F2N4O2 — CID 133424962
6-[[4-(difluoromethoxy)phenyl]methyl-methylamino]pyrazine-2-carboxamide (PubChem CID 133424962) has the molecular formula C14H14F2N4O2 and a molecular weight of 308.29 g/mol. Its IUPAC name is 6-[[4-(difluoromethoxy)phenyl]methyl-methylamino]pyrazine-2-carboxamide.
| Compound Name | 6-[[4-(difluoromethoxy)phenyl]methyl-methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133424962 |
| Molecular Formula | C14H14F2N4O2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 6-[[4-(difluoromethoxy)phenyl]methyl-methylamino]pyrazine-2-carboxamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)c1cncc(C(N)=O)n1 |
| InChI | InChI=1S/C14H14F2N4O2/c1-20(12-7-18-6-11(19-12)13(17)21)8-9-2-4-10(5-3-9)22-14(15)16/h2-7,14H,8H2,1H3,(H2,17,21) |
| InChIKey | JAFYFDNCIPWICO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |