C13H17F2N3O3 — CID 60938031
2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanediamide (PubChem CID 60938031) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanediamide.
| Compound Name | 2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanediamide |
|---|---|
| PubChem CID | 60938031 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-amino-N-[[4-(difluoromethoxy)phenyl]methyl]-N-methylbutanediamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C13H17F2N3O3/c1-18(12(20)10(16)6-11(17)19)7-8-2-4-9(5-3-8)21-13(14)15/h2-5,10,13H,6-7,16H2,1H3,(H2,17,19) |
| InChIKey | OATFDCDJNUCBGF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |