C14H21N3O4 — CID 60937652
2-amino-N-[(3,4-dimethoxyphenyl)methyl]-N-methylbutanediamide (PubChem CID 60937652) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-amino-N-[(3,4-dimethoxyphenyl)methyl]-N-methylbutanediamide.
| Compound Name | 2-amino-N-[(3,4-dimethoxyphenyl)methyl]-N-methylbutanediamide |
|---|---|
| PubChem CID | 60937652 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-amino-N-[(3,4-dimethoxyphenyl)methyl]-N-methylbutanediamide |
| SMILES | COc1ccc(CN(C)C(=O)C(N)CC(N)=O)cc1OC |
| InChI | InChI=1S/C14H21N3O4/c1-17(14(19)10(15)7-13(16)18)8-9-4-5-11(20-2)12(6-9)21-3/h4-6,10H,7-8,15H2,1-3H3,(H2,16,18) |
| InChIKey | XFUFMLCXPUAUOR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |