C11H6ClN3O2S — CID 133425252
4-[(3-chloro-4-cyano-1,2-thiazol-5-yl)oxy]benzamide (PubChem CID 133425252) has the molecular formula C11H6ClN3O2S and a molecular weight of 279.71 g/mol. Its IUPAC name is 4-[(3-chloro-4-cyano-1,2-thiazol-5-yl)oxy]benzamide.
| Compound Name | 4-[(3-chloro-4-cyano-1,2-thiazol-5-yl)oxy]benzamide |
|---|---|
| PubChem CID | 133425252 |
| Molecular Formula | C11H6ClN3O2S |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 4-[(3-chloro-4-cyano-1,2-thiazol-5-yl)oxy]benzamide |
| SMILES | N#Cc1c(Cl)nsc1Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H6ClN3O2S/c12-9-8(5-13)11(18-15-9)17-7-3-1-6(2-4-7)10(14)16/h1-4H,(H2,14,16) |
| InChIKey | NIEIAKOHCTUQPN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |