C18H16F2N6OS2 — CID 133425585
2-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 133425585) has the molecular formula C18H16F2N6OS2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 133425585 |
| Molecular Formula | C18H16F2N6OS2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-[[3-(difluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c(Sc2ccc3nnc(C(F)F)n3n2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C18H16F2N6OS2/c1-2-25-17(27)13-9-5-3-4-6-10(9)28-16(13)21-18(25)29-12-8-7-11-22-23-15(14(19)20)26(11)24-12/h7-8,14H,2-6H2,1H3 |
| InChIKey | UCKHEZFFBHIECJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |