C17H18N4OS3 — CID 133425587
2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 133425587) has the molecular formula C17H18N4OS3 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 133425587 |
| Molecular Formula | C17H18N4OS3 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-[(3-cyclopropyl-1,2,4-thiadiazol-5-yl)sulfanyl]-3-ethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c(Sc2nc(C3CC3)ns2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C17H18N4OS3/c1-2-21-15(22)12-10-5-3-4-6-11(10)23-14(12)19-16(21)24-17-18-13(20-25-17)9-7-8-9/h9H,2-8H2,1H3 |
| InChIKey | KFJAMFWIWIYOLA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |