C16H18N4OS3 — CID 133425445
3-methyl-2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 133425445) has the molecular formula C16H18N4OS3 and a molecular weight of 378.55 g/mol. Its IUPAC name is 3-methyl-2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 133425445 |
| Molecular Formula | C16H18N4OS3 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 3-methyl-2-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CC(C)c1nsc(Sc2nc3sc4c(c3c(=O)n2C)CCCC4)n1 |
| InChI | InChI=1S/C16H18N4OS3/c1-8(2)12-17-16(24-19-12)23-15-18-13-11(14(21)20(15)3)9-6-4-5-7-10(9)22-13/h8H,4-7H2,1-3H3 |
| InChIKey | OXRKEAPCLLUZAZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |