C17H15N3O3S2 — CID 7492263
3-methyl-2-(2-nitrophenyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7492263) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-methyl-2-(2-nitrophenyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-(2-nitrophenyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7492263 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 3-methyl-2-(2-nitrophenyl)sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cn1c(Sc2ccccc2[N+](=O)[O-])nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C17H15N3O3S2/c1-19-16(21)14-10-6-2-4-8-12(10)24-15(14)18-17(19)25-13-9-5-3-7-11(13)20(22)23/h3,5,7,9H,2,4,6,8H2,1H3 |
| InChIKey | YMPUZBJBFIPOHU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|