C17H13F2N3O4S2 — CID 133425485
10-[3-(difluoromethoxy)-4-nitrophenyl]sulfanyl-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 133425485) has the molecular formula C17H13F2N3O4S2 and a molecular weight of 425.44 g/mol. Its IUPAC name is 10-[3-(difluoromethoxy)-4-nitrophenyl]sulfanyl-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[3-(difluoromethoxy)-4-nitrophenyl]sulfanyl-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 133425485 |
| Molecular Formula | C17H13F2N3O4S2 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 10-[3-(difluoromethoxy)-4-nitrophenyl]sulfanyl-11-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | Cn1c(Sc2ccc([N+](=O)[O-])c(OC(F)F)c2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C17H13F2N3O4S2/c1-21-15(23)13-9-3-2-4-12(9)28-14(13)20-17(21)27-8-5-6-10(22(24)25)11(7-8)26-16(18)19/h5-7,16H,2-4H2,1H3 |
| InChIKey | IQVGYCLFCRRXLY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|