C13H14N2O4S — CID 133426823
2-(3-ethoxy-4-nitrophenyl)sulfanyl-4,5-dimethyl-1,3-oxazole (PubChem CID 133426823) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-(3-ethoxy-4-nitrophenyl)sulfanyl-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-(3-ethoxy-4-nitrophenyl)sulfanyl-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 133426823 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(3-ethoxy-4-nitrophenyl)sulfanyl-4,5-dimethyl-1,3-oxazole |
| SMILES | CCOc1cc(Sc2nc(C)c(C)o2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N2O4S/c1-4-18-12-7-10(5-6-11(12)15(16)17)20-13-14-8(2)9(3)19-13/h5-7H,4H2,1-3H3 |
| InChIKey | OJGAXKMAESJDNW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|